C16H23NO5S — CID 119203959
4-methyl-4-[(4-propan-2-ylsulfonylbenzoyl)amino]pentanoic acid (PubChem CID 119203959) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-methyl-4-[(4-propan-2-ylsulfonylbenzoyl)amino]pentanoic acid.
| Compound Name | 4-methyl-4-[(4-propan-2-ylsulfonylbenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119203959 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-methyl-4-[(4-propan-2-ylsulfonylbenzoyl)amino]pentanoic acid |
| SMILES | CC(C)S(=O)(=O)c1ccc(C(=O)NC(C)(C)CCC(=O)O)cc1 |
| InChI | InChI=1S/C16H23NO5S/c1-11(2)23(21,22)13-7-5-12(6-8-13)15(20)17-16(3,4)10-9-14(18)19/h5-8,11H,9-10H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | UIWDZWRUYMGHHU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |