C16H21N3O5S — CID 122091461
4-[[4-(1-cyanoethylsulfonyl)phenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122091461) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 4-[[4-(1-cyanoethylsulfonyl)phenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[4-(1-cyanoethylsulfonyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122091461 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-[[4-(1-cyanoethylsulfonyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C#N)S(=O)(=O)c1ccc(NC(=O)NC(C)(C)CCC(=O)O)cc1 |
| InChI | InChI=1S/C16H21N3O5S/c1-11(10-17)25(23,24)13-6-4-12(5-7-13)18-15(22)19-16(2,3)9-8-14(20)21/h4-7,11H,8-9H2,1-3H3,(H,20,21)(H2,18,19,22) |
| InChIKey | BRQGLNZFJMFXCE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |