C17H27N3O5S — CID 122087045
4-[[3-(butan-2-ylsulfamoyl)phenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122087045) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-[[3-(butan-2-ylsulfamoyl)phenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[3-(butan-2-ylsulfamoyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122087045 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[[3-(butan-2-ylsulfamoyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CCC(C)NS(=O)(=O)c1cccc(NC(=O)NC(C)(C)CCC(=O)O)c1 |
| InChI | InChI=1S/C17H27N3O5S/c1-5-12(2)20-26(24,25)14-8-6-7-13(11-14)18-16(23)19-17(3,4)10-9-15(21)22/h6-8,11-12,20H,5,9-10H2,1-4H3,(H,21,22)(H2,18,19,23) |
| InChIKey | JGDNJFPDFVHGRT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |