C17H24N2O5S — CID 122088062
4-[[3-(3-methoxy-3-oxopropyl)sulfanylphenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122088062) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-[[3-(3-methoxy-3-oxopropyl)sulfanylphenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[3-(3-methoxy-3-oxopropyl)sulfanylphenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122088062 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-[[3-(3-methoxy-3-oxopropyl)sulfanylphenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | COC(=O)CCSc1cccc(NC(=O)NC(C)(C)CCC(=O)O)c1 |
| InChI | InChI=1S/C17H24N2O5S/c1-17(2,9-7-14(20)21)19-16(23)18-12-5-4-6-13(11-12)25-10-8-15(22)24-3/h4-6,11H,7-10H2,1-3H3,(H,20,21)(H2,18,19,23) |
| InChIKey | NCSOTNYRGSCEPS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |