C19H27N3O4 — CID 122076790
4-[[4-(cyclopentylcarbamoyl)phenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122076790) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-[[4-(cyclopentylcarbamoyl)phenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[4-(cyclopentylcarbamoyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122076790 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4-[[4-(cyclopentylcarbamoyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)Nc1ccc(C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C19H27N3O4/c1-19(2,12-11-16(23)24)22-18(26)21-15-9-7-13(8-10-15)17(25)20-14-5-3-4-6-14/h7-10,14H,3-6,11-12H2,1-2H3,(H,20,25)(H,23,24)(H2,21,22,26) |
| InChIKey | VYMKABDKHMILHP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |