C22H25N3O4 — CID 122076784
3-[3-[[4-(cyclopentylcarbamoyl)phenyl]carbamoylamino]phenyl]propanoic acid (PubChem CID 122076784) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[3-[[4-(cyclopentylcarbamoyl)phenyl]carbamoylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[4-(cyclopentylcarbamoyl)phenyl]carbamoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122076784 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-[3-[[4-(cyclopentylcarbamoyl)phenyl]carbamoylamino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(NC(=O)Nc2ccc(C(=O)NC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C22H25N3O4/c26-20(27)13-8-15-4-3-7-19(14-15)25-22(29)24-18-11-9-16(10-12-18)21(28)23-17-5-1-2-6-17/h3-4,7,9-12,14,17H,1-2,5-6,8,13H2,(H,23,28)(H,26,27)(H2,24,25,29) |
| InChIKey | BWYZZYMWZCBPIM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |