C15H21N3O4S — CID 99800160
1-[4-[(1R)-1-cyanoethyl]sulfonylphenyl]-3-[(2R)-4-methoxybutan-2-yl]urea (PubChem CID 99800160) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-[4-[(1R)-1-cyanoethyl]sulfonylphenyl]-3-[(2R)-4-methoxybutan-2-yl]urea.
| Compound Name | 1-[4-[(1R)-1-cyanoethyl]sulfonylphenyl]-3-[(2R)-4-methoxybutan-2-yl]urea |
|---|---|
| PubChem CID | 99800160 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-[4-[(1R)-1-cyanoethyl]sulfonylphenyl]-3-[(2R)-4-methoxybutan-2-yl]urea |
| SMILES | COCC[C@@H](C)NC(=O)Nc1ccc(S(=O)(=O)[C@H](C)C#N)cc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-11(8-9-22-3)17-15(19)18-13-4-6-14(7-5-13)23(20,21)12(2)10-16/h4-7,11-12H,8-9H2,1-3H3,(H2,17,18,19)/t11-,12-/m1/s1 |
| InChIKey | BFTRRBWASIQYNP-VXGBXAGGSA-N |
| XLogP | 1.92 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |