C14H22FN3O4S — CID 56806689
1-[5-(dimethylsulfamoyl)-2-fluorophenyl]-3-(4-methoxybutan-2-yl)urea (PubChem CID 56806689) has the molecular formula C14H22FN3O4S and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-[5-(dimethylsulfamoyl)-2-fluorophenyl]-3-(4-methoxybutan-2-yl)urea.
| Compound Name | 1-[5-(dimethylsulfamoyl)-2-fluorophenyl]-3-(4-methoxybutan-2-yl)urea |
|---|---|
| PubChem CID | 56806689 |
| Molecular Formula | C14H22FN3O4S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[5-(dimethylsulfamoyl)-2-fluorophenyl]-3-(4-methoxybutan-2-yl)urea |
| SMILES | COCCC(C)NC(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1F |
| InChI | InChI=1S/C14H22FN3O4S/c1-10(7-8-22-4)16-14(19)17-13-9-11(5-6-12(13)15)23(20,21)18(2)3/h5-6,9-10H,7-8H2,1-4H3,(H2,16,17,19) |
| InChIKey | OGRHHMMFLOVJEV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |