C12H15ClFNO4S — CID 64603638
3-fluoro-4-(4-methoxybutan-2-ylcarbamoyl)benzenesulfonyl chloride (PubChem CID 64603638) has the molecular formula C12H15ClFNO4S and a molecular weight of 323.77 g/mol. Its IUPAC name is 3-fluoro-4-(4-methoxybutan-2-ylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 3-fluoro-4-(4-methoxybutan-2-ylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 64603638 |
| Molecular Formula | C12H15ClFNO4S |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-fluoro-4-(4-methoxybutan-2-ylcarbamoyl)benzenesulfonyl chloride |
| SMILES | COCCC(C)NC(=O)c1ccc(S(=O)(=O)Cl)cc1F |
| InChI | InChI=1S/C12H15ClFNO4S/c1-8(5-6-19-2)15-12(16)10-4-3-9(7-11(10)14)20(13,17)18/h3-4,7-8H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | AXCBEGUMBRVYMA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |