C15H22ClNO3S — CID 63927112
3-methyl-4-(5-methylhexan-2-ylcarbamoyl)benzenesulfonyl chloride (PubChem CID 63927112) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 3-methyl-4-(5-methylhexan-2-ylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 3-methyl-4-(5-methylhexan-2-ylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 63927112 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-methyl-4-(5-methylhexan-2-ylcarbamoyl)benzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)ccc1C(=O)NC(C)CCC(C)C |
| InChI | InChI=1S/C15H22ClNO3S/c1-10(2)5-6-12(4)17-15(18)14-8-7-13(9-11(14)3)21(16,19)20/h7-10,12H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | BYWDKUOGOOPQRZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |