C13H18ClNO3S — CID 43372353
4-(4-methylpentan-2-ylcarbamoyl)benzenesulfonyl chloride (PubChem CID 43372353) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 4-(4-methylpentan-2-ylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 4-(4-methylpentan-2-ylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43372353 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-(4-methylpentan-2-ylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CC(C)CC(C)NC(=O)c1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-9(2)8-10(3)15-13(16)11-4-6-12(7-5-11)19(14,17)18/h4-7,9-10H,8H2,1-3H3,(H,15,16) |
| InChIKey | PSSOFIQDXUTGEV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |