C12H19ClN2O3S — CID 65367479
5-(5-methylhexan-2-ylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride (PubChem CID 65367479) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.82 g/mol. Its IUPAC name is 5-(5-methylhexan-2-ylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride.
| Compound Name | 5-(5-methylhexan-2-ylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 65367479 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-(5-methylhexan-2-ylcarbamoyl)-1H-pyrrole-3-sulfonyl chloride |
| SMILES | CC(C)CCC(C)NC(=O)c1cc(S(=O)(=O)Cl)c[nH]1 |
| InChI | InChI=1S/C12H19ClN2O3S/c1-8(2)4-5-9(3)15-12(16)11-6-10(7-14-11)19(13,17)18/h6-9,14H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | XZINSSMPJPGQQW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |