C14H19FN2O6S — CID 7976212
[2-(2-methoxyethylamino)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7976212) has the molecular formula C14H19FN2O6S and a molecular weight of 362.38 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7976212 |
| Molecular Formula | C14H19FN2O6S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | COCCNC(=O)COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1F |
| InChI | InChI=1S/C14H19FN2O6S/c1-17(2)24(20,21)10-4-5-12(15)11(8-10)14(19)23-9-13(18)16-6-7-22-3/h4-5,8H,6-7,9H2,1-3H3,(H,16,18) |
| InChIKey | DDRUYFPTXCIFHS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|