C13H19FN2O4S — CID 95774605
(2R)-N-[5-(dimethylsulfamoyl)-2-fluorophenyl]-2-methoxybutanamide (PubChem CID 95774605) has the molecular formula C13H19FN2O4S and a molecular weight of 318.37 g/mol. Its IUPAC name is (2R)-N-[5-(dimethylsulfamoyl)-2-fluorophenyl]-2-methoxybutanamide.
| Compound Name | (2R)-N-[5-(dimethylsulfamoyl)-2-fluorophenyl]-2-methoxybutanamide |
|---|---|
| PubChem CID | 95774605 |
| Molecular Formula | C13H19FN2O4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2R)-N-[5-(dimethylsulfamoyl)-2-fluorophenyl]-2-methoxybutanamide |
| SMILES | CC[C@@H](OC)C(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1F |
| InChI | InChI=1S/C13H19FN2O4S/c1-5-12(20-4)13(17)15-11-8-9(6-7-10(11)14)21(18,19)16(2)3/h6-8,12H,5H2,1-4H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | JDWUJJQWNGCLSP-GFCCVEGCSA-N |
| XLogP | 1.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |