C17H23N3O3S — CID 122079776
4-[[2-(2-cyanopropylsulfanyl)phenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122079776) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-[[2-(2-cyanopropylsulfanyl)phenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[2-(2-cyanopropylsulfanyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122079776 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-[[2-(2-cyanopropylsulfanyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C#N)CSc1ccccc1NC(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C17H23N3O3S/c1-12(10-18)11-24-14-7-5-4-6-13(14)19-16(23)20-17(2,3)9-8-15(21)22/h4-7,12H,8-9,11H2,1-3H3,(H,21,22)(H2,19,20,23) |
| InChIKey | CFKJPFRQGHVDIQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |