C16H21N3OS — CID 86900806
N-[2-(2-cyanopropylsulfanyl)phenyl]-3-methylpyrrolidine-1-carboxamide (PubChem CID 86900806) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is N-[2-(2-cyanopropylsulfanyl)phenyl]-3-methylpyrrolidine-1-carboxamide.
| Compound Name | N-[2-(2-cyanopropylsulfanyl)phenyl]-3-methylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 86900806 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[2-(2-cyanopropylsulfanyl)phenyl]-3-methylpyrrolidine-1-carboxamide |
| SMILES | CC(C#N)CSc1ccccc1NC(=O)N1CCC(C)C1 |
| InChI | InChI=1S/C16H21N3OS/c1-12-7-8-19(10-12)16(20)18-14-5-3-4-6-15(14)21-11-13(2)9-17/h3-6,12-13H,7-8,10-11H2,1-2H3,(H,18,20) |
| InChIKey | GXKXGNSQOWSRSV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |