C14H18F2N2OS — CID 115581860
N-[2-(difluoromethylsulfanyl)phenyl]-4-methylpiperidine-1-carboxamide (PubChem CID 115581860) has the molecular formula C14H18F2N2OS and a molecular weight of 300.37 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-4-methylpiperidine-1-carboxamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 115581860 |
| Molecular Formula | C14H18F2N2OS |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-4-methylpiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)Nc2ccccc2SC(F)F)CC1 |
| InChI | InChI=1S/C14H18F2N2OS/c1-10-6-8-18(9-7-10)14(19)17-11-4-2-3-5-12(11)20-13(15)16/h2-5,10,13H,6-9H2,1H3,(H,17,19) |
| InChIKey | KNLYFHOQTSQQSJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |