C14H16F2N2O2S — CID 78799115
1-acetyl-N-[2-(difluoromethylsulfanyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 78799115) has the molecular formula C14H16F2N2O2S and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-acetyl-N-[2-(difluoromethylsulfanyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-acetyl-N-[2-(difluoromethylsulfanyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 78799115 |
| Molecular Formula | C14H16F2N2O2S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-acetyl-N-[2-(difluoromethylsulfanyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CCCC1C(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C14H16F2N2O2S/c1-9(19)18-8-4-6-11(18)13(20)17-10-5-2-3-7-12(10)21-14(15)16/h2-3,5,7,11,14H,4,6,8H2,1H3,(H,17,20) |
| InChIKey | KEULLPCNQMQYBP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |