C19H19FN2O3S — CID 22181509
2-[[2-fluoro-4-(2-methylsulfanylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylic acid (PubChem CID 22181509) has the molecular formula C19H19FN2O3S and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[[2-fluoro-4-(2-methylsulfanylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[[2-fluoro-4-(2-methylsulfanylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22181509 |
| Molecular Formula | C19H19FN2O3S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[[2-fluoro-4-(2-methylsulfanylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylic acid |
| SMILES | CSc1ccccc1-c1ccc(NC(=O)C2CCCN2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C19H19FN2O3S/c1-26-17-7-3-2-5-13(17)12-8-9-15(14(20)11-12)21-18(23)16-6-4-10-22(16)19(24)25/h2-3,5,7-9,11,16H,4,6,10H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | WFAKSICPBYRZEL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |