C19H18FIN2O3 — CID 69025622
benzyl 2-[(2-fluoro-4-iodophenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 69025622) has the molecular formula C19H18FIN2O3 and a molecular weight of 468.27 g/mol. Its IUPAC name is benzyl 2-[(2-fluoro-4-iodophenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(2-fluoro-4-iodophenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69025622 |
| Molecular Formula | C19H18FIN2O3 |
| Molecular Weight | 468.27 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | benzyl 2-[(2-fluoro-4-iodophenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1ccc(I)cc1F)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18FIN2O3/c20-15-11-14(21)8-9-16(15)22-18(24)17-7-4-10-23(17)19(25)26-12-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,17H,4,7,10,12H2,(H,22,24) |
| InChIKey | WUFJZYPAVQFPPA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|