C19H20N2O3S — CID 22181596
2-[[4-(2-methylsulfanylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylic acid (PubChem CID 22181596) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-[[4-(2-methylsulfanylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[[4-(2-methylsulfanylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22181596 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[[4-(2-methylsulfanylphenyl)phenyl]carbamoyl]pyrrolidine-1-carboxylic acid |
| SMILES | CSc1ccccc1-c1ccc(NC(=O)C2CCCN2C(=O)O)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-25-17-7-3-2-5-15(17)13-8-10-14(11-9-13)20-18(22)16-6-4-12-21(16)19(23)24/h2-3,5,7-11,16H,4,6,12H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | FVKBKTYPOBNNJS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |