C15H18F2N2O3S — CID 122101912
1-[[2-(difluoromethylsulfanyl)phenyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122101912) has the molecular formula C15H18F2N2O3S and a molecular weight of 344.38 g/mol. Its IUPAC name is 1-[[2-(difluoromethylsulfanyl)phenyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[[2-(difluoromethylsulfanyl)phenyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122101912 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-[[2-(difluoromethylsulfanyl)phenyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)Nc2ccccc2SC(F)F)C1 |
| InChI | InChI=1S/C15H18F2N2O3S/c1-9-6-10(13(20)21)8-19(7-9)15(22)18-11-4-2-3-5-12(11)23-14(16)17/h2-5,9-10,14H,6-8H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | QZOBTURMRZMLCA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |