C17H26N2O4 — CID 122077360
4-[(2-butoxyphenyl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 122077360) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is 4-[(2-butoxyphenyl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[(2-butoxyphenyl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122077360 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-[(2-butoxyphenyl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CCCCOc1ccccc1NC(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C17H26N2O4/c1-4-5-12-23-14-9-7-6-8-13(14)18-16(22)19-17(2,3)11-10-15(20)21/h6-9H,4-5,10-12H2,1-3H3,(H,20,21)(H2,18,19,22) |
| InChIKey | OHWRHTZPIHESNS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|