C19H28N2O5 — CID 122077814
4-methyl-4-[[2-(oxan-2-ylmethoxy)phenyl]carbamoylamino]pentanoic acid (PubChem CID 122077814) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-methyl-4-[[2-(oxan-2-ylmethoxy)phenyl]carbamoylamino]pentanoic acid.
| Compound Name | 4-methyl-4-[[2-(oxan-2-ylmethoxy)phenyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122077814 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-methyl-4-[[2-(oxan-2-ylmethoxy)phenyl]carbamoylamino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)Nc1ccccc1OCC1CCCCO1 |
| InChI | InChI=1S/C19H28N2O5/c1-19(2,11-10-17(22)23)21-18(24)20-15-8-3-4-9-16(15)26-13-14-7-5-6-12-25-14/h3-4,8-9,14H,5-7,10-13H2,1-2H3,(H,22,23)(H2,20,21,24) |
| InChIKey | GDTXGZIFLUHBFC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |