C18H21N3O2S — CID 95308178
1-[2-[(2S)-2-cyanopropyl]sulfanylphenyl]-3-[(2R)-1-(furan-2-yl)propan-2-yl]urea (PubChem CID 95308178) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[2-[(2S)-2-cyanopropyl]sulfanylphenyl]-3-[(2R)-1-(furan-2-yl)propan-2-yl]urea.
| Compound Name | 1-[2-[(2S)-2-cyanopropyl]sulfanylphenyl]-3-[(2R)-1-(furan-2-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 95308178 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[2-[(2S)-2-cyanopropyl]sulfanylphenyl]-3-[(2R)-1-(furan-2-yl)propan-2-yl]urea |
| SMILES | CC(C#N)CSc1ccccc1NC(=O)N[C@H](C)Cc1ccco1 |
| InChI | InChI=1S/C18H21N3O2S/c1-13(11-19)12-24-17-8-4-3-7-16(17)21-18(22)20-14(2)10-15-6-5-9-23-15/h3-9,13-14H,10,12H2,1-2H3,(H2,20,21,22)/t13?,14-/m1/s1 |
| InChIKey | FIMIPDNDBPNCEE-ARLHGKGLSA-N |
| XLogP | 4.28 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |