C14H15ClN2O2 — CID 166475971
7-chloro-N-[(2S,3S)-2-methyloxolan-3-yl]-1H-indole-2-carboxamide (PubChem CID 166475971) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 7-chloro-N-[(2S,3S)-2-methyloxolan-3-yl]-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-[(2S,3S)-2-methyloxolan-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166475971 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 7-chloro-N-[(2S,3S)-2-methyloxolan-3-yl]-1H-indole-2-carboxamide |
| SMILES | C[C@@H]1OCC[C@@H]1NC(=O)c1cc2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C14H15ClN2O2/c1-8-11(5-6-19-8)17-14(18)12-7-9-3-2-4-10(15)13(9)16-12/h2-4,7-8,11,16H,5-6H2,1H3,(H,17,18)/t8-,11-/m0/s1 |
| InChIKey | ALJIGJROSXIFRO-KWQFWETISA-N |
| XLogP | 2.73 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |