C14H15ClN2O2 — CID 110849434
7-chloro-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 110849434) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 7-chloro-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110849434 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 7-chloro-N-(oxolan-2-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C14H15ClN2O2/c15-11-5-1-3-9-7-12(17-13(9)11)14(18)16-8-10-4-2-6-19-10/h1,3,5,7,10,17H,2,4,6,8H2,(H,16,18) |
| InChIKey | RAFMYUJPHPVWBO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |