C14H15BrN2O2 — CID 39977668
6-bromo-N-[[(2S)-oxolan-2-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 39977668) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 6-bromo-N-[[(2S)-oxolan-2-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 6-bromo-N-[[(2S)-oxolan-2-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39977668 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 6-bromo-N-[[(2S)-oxolan-2-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1cc2ccc(Br)cc2[nH]1 |
| InChI | InChI=1S/C14H15BrN2O2/c15-10-4-3-9-6-13(17-12(9)7-10)14(18)16-8-11-2-1-5-19-11/h3-4,6-7,11,17H,1-2,5,8H2,(H,16,18)/t11-/m0/s1 |
| InChIKey | GIXXYCRFIWQLJD-NSHDSACASA-N |
| XLogP | 2.84 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |