C18H24N2O3 — CID 97008925
6-tert-butyl-N-[[(2R)-1,4-dioxan-2-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 97008925) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 6-tert-butyl-N-[[(2R)-1,4-dioxan-2-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 6-tert-butyl-N-[[(2R)-1,4-dioxan-2-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 97008925 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 6-tert-butyl-N-[[(2R)-1,4-dioxan-2-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | CC(C)(C)c1ccc2cc(C(=O)NC[C@@H]3COCCO3)[nH]c2c1 |
| InChI | InChI=1S/C18H24N2O3/c1-18(2,3)13-5-4-12-8-16(20-15(12)9-13)17(21)19-10-14-11-22-6-7-23-14/h4-5,8-9,14,20H,6-7,10-11H2,1-3H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | GFBLEOMQZAAQLO-CQSZACIVSA-N |
| XLogP | 2.61 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |