C10H14ClN3O4S — CID 65371213
5-ethyl-3-(morpholine-4-carbonyl)-1H-pyrazole-4-sulfonyl chloride (PubChem CID 65371213) has the molecular formula C10H14ClN3O4S and a molecular weight of 307.76 g/mol. Its IUPAC name is 5-ethyl-3-(morpholine-4-carbonyl)-1H-pyrazole-4-sulfonyl chloride.
| Compound Name | 5-ethyl-3-(morpholine-4-carbonyl)-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 65371213 |
| Molecular Formula | C10H14ClN3O4S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 5-ethyl-3-(morpholine-4-carbonyl)-1H-pyrazole-4-sulfonyl chloride |
| SMILES | CCc1[nH]nc(C(=O)N2CCOCC2)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H14ClN3O4S/c1-2-7-9(19(11,16)17)8(13-12-7)10(15)14-3-5-18-6-4-14/h2-6H2,1H3,(H,12,13) |
| InChIKey | QSQXQDXUFCPRQV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |