C9H13ClN2O5S — CID 65373730
2-methoxyethyl 4-chlorosulfonyl-5-ethyl-1H-pyrazole-3-carboxylate (PubChem CID 65373730) has the molecular formula C9H13ClN2O5S and a molecular weight of 296.73 g/mol. Its IUPAC name is 2-methoxyethyl 4-chlorosulfonyl-5-ethyl-1H-pyrazole-3-carboxylate.
| Compound Name | 2-methoxyethyl 4-chlorosulfonyl-5-ethyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 65373730 |
| Molecular Formula | C9H13ClN2O5S |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-methoxyethyl 4-chlorosulfonyl-5-ethyl-1H-pyrazole-3-carboxylate |
| SMILES | CCc1[nH]nc(C(=O)OCCOC)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H13ClN2O5S/c1-3-6-8(18(10,14)15)7(12-11-6)9(13)17-5-4-16-2/h3-5H2,1-2H3,(H,11,12) |
| InChIKey | UWHWMETVXKWMBS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|