C11H17ClN2O5S — CID 106450810
2-(2-methylpropoxy)ethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate (PubChem CID 106450810) has the molecular formula C11H17ClN2O5S and a molecular weight of 324.79 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate.
| Compound Name | 2-(2-methylpropoxy)ethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 106450810 |
| Molecular Formula | C11H17ClN2O5S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate |
| SMILES | Cc1[nH]nc(C(=O)OCCOCC(C)C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H17ClN2O5S/c1-7(2)6-18-4-5-19-11(15)9-10(20(12,16)17)8(3)13-14-9/h7H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | PADXHTSPGAMWCI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|