C10H16ClN3O3S — CID 65371867
3-[butan-2-yl(methyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride (PubChem CID 65371867) has the molecular formula C10H16ClN3O3S and a molecular weight of 293.78 g/mol. Its IUPAC name is 3-[butan-2-yl(methyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride.
| Compound Name | 3-[butan-2-yl(methyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 65371867 |
| Molecular Formula | C10H16ClN3O3S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-[butan-2-yl(methyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride |
| SMILES | CCC(C)N(C)C(=O)c1n[nH]c(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H16ClN3O3S/c1-5-6(2)14(4)10(15)8-9(18(11,16)17)7(3)12-13-8/h6H,5H2,1-4H3,(H,12,13) |
| InChIKey | IHAOOZDTWAGXKS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |