C10H16ClN3O4S — CID 65398569
3-[3-methoxypropyl(methyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride (PubChem CID 65398569) has the molecular formula C10H16ClN3O4S and a molecular weight of 309.78 g/mol. Its IUPAC name is 3-[3-methoxypropyl(methyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride.
| Compound Name | 3-[3-methoxypropyl(methyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 65398569 |
| Molecular Formula | C10H16ClN3O4S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3-[3-methoxypropyl(methyl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride |
| SMILES | COCCCN(C)C(=O)c1n[nH]c(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H16ClN3O4S/c1-7-9(19(11,16)17)8(13-12-7)10(15)14(2)5-4-6-18-3/h4-6H2,1-3H3,(H,12,13) |
| InChIKey | LLXAICJDNIBYEL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|