C11H18N4O4S — CID 65386491
N-cyclopropyl-N-(2-methoxyethyl)-5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65386491) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-cyclopropyl-N-(2-methoxyethyl)-5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-cyclopropyl-N-(2-methoxyethyl)-5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65386491 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-cyclopropyl-N-(2-methoxyethyl)-5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | COCCN(C(=O)c1n[nH]c(C)c1S(N)(=O)=O)C1CC1 |
| InChI | InChI=1S/C11H18N4O4S/c1-7-10(20(12,17)18)9(14-13-7)11(16)15(5-6-19-2)8-3-4-8/h8H,3-6H2,1-2H3,(H,13,14)(H2,12,17,18) |
| InChIKey | OPPAKGHBDKHSHY-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |