C11H18ClN3O4S — CID 65398061
3-[(1-methoxy-3-methylbutan-2-yl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride (PubChem CID 65398061) has the molecular formula C11H18ClN3O4S and a molecular weight of 323.80 g/mol. Its IUPAC name is 3-[(1-methoxy-3-methylbutan-2-yl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride.
| Compound Name | 3-[(1-methoxy-3-methylbutan-2-yl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 65398061 |
| Molecular Formula | C11H18ClN3O4S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-[(1-methoxy-3-methylbutan-2-yl)carbamoyl]-5-methyl-1H-pyrazole-4-sulfonyl chloride |
| SMILES | COCC(NC(=O)c1n[nH]c(C)c1S(=O)(=O)Cl)C(C)C |
| InChI | InChI=1S/C11H18ClN3O4S/c1-6(2)8(5-19-4)13-11(16)9-10(20(12,17)18)7(3)14-15-9/h6,8H,5H2,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | IMPCHSBPKFOBEE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |