C12H22N4O3S — CID 65387069
N-heptan-2-yl-5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65387069) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-heptan-2-yl-5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-heptan-2-yl-5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65387069 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-heptan-2-yl-5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1n[nH]c(C)c1S(N)(=O)=O |
| InChI | InChI=1S/C12H22N4O3S/c1-4-5-6-7-8(2)14-12(17)10-11(20(13,18)19)9(3)15-16-10/h8H,4-7H2,1-3H3,(H,14,17)(H,15,16)(H2,13,18,19) |
| InChIKey | HBYFYOURYUYFRC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|