C9H16N4O4S2 — CID 113484535
5-methyl-N-(2-methylsulfinylpropyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 113484535) has the molecular formula C9H16N4O4S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 5-methyl-N-(2-methylsulfinylpropyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-(2-methylsulfinylpropyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 113484535 |
| Molecular Formula | C9H16N4O4S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-methyl-N-(2-methylsulfinylpropyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCC(C)S(C)=O)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H16N4O4S2/c1-5(18(3)15)4-11-9(14)7-8(19(10,16)17)6(2)12-13-7/h5H,4H2,1-3H3,(H,11,14)(H,12,13)(H2,10,16,17) |
| InChIKey | FMGTVPGVBHLCPW-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |