C9H15N3O4S — CID 65382029
butan-2-yl 5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxylate (PubChem CID 65382029) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is butan-2-yl 5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxylate.
| Compound Name | butan-2-yl 5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 65382029 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | butan-2-yl 5-methyl-4-sulfamoyl-1H-pyrazole-3-carboxylate |
| SMILES | CCC(C)OC(=O)c1n[nH]c(C)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H15N3O4S/c1-4-5(2)16-9(13)7-8(17(10,14)15)6(3)11-12-7/h5H,4H2,1-3H3,(H,11,12)(H2,10,14,15) |
| InChIKey | KVRRNCXBRODLJH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |