C11H20N4O3S — CID 65388989
5-methyl-N-(2-methylpentan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65388989) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 5-methyl-N-(2-methylpentan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-(2-methylpentan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65388989 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-methyl-N-(2-methylpentan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCC(NC(=O)c1n[nH]c(C)c1S(N)(=O)=O)C(C)C |
| InChI | InChI=1S/C11H20N4O3S/c1-5-8(6(2)3)13-11(16)9-10(19(12,17)18)7(4)14-15-9/h6,8H,5H2,1-4H3,(H,13,16)(H,14,15)(H2,12,17,18) |
| InChIKey | SNILJQNENULECN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |