C12H22N4O3S — CID 65387211
5-ethyl-N-(4-methylpentan-2-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65387211) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 5-ethyl-N-(4-methylpentan-2-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-ethyl-N-(4-methylpentan-2-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65387211 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-ethyl-N-(4-methylpentan-2-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)NC(C)CC(C)C)c1S(N)(=O)=O |
| InChI | InChI=1S/C12H22N4O3S/c1-5-9-11(20(13,18)19)10(16-15-9)12(17)14-8(4)6-7(2)3/h7-8H,5-6H2,1-4H3,(H,14,17)(H,15,16)(H2,13,18,19) |
| InChIKey | PNXIIZZZXWZCGU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |