C13H24N4O3S — CID 65388449
N-hexan-2-yl-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65388449) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-hexan-2-yl-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-hexan-2-yl-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65388449 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-hexan-2-yl-5-propyl-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | CCCCC(C)NC(=O)c1n[nH]c(CCC)c1S(N)(=O)=O |
| InChI | InChI=1S/C13H24N4O3S/c1-4-6-8-9(3)15-13(18)11-12(21(14,19)20)10(7-5-2)16-17-11/h9H,4-8H2,1-3H3,(H,15,18)(H,16,17)(H2,14,19,20) |
| InChIKey | MJXFRHGOYPCCEK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |