C13H21ClN2O4S — CID 65374892
octan-2-yl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate (PubChem CID 65374892) has the molecular formula C13H21ClN2O4S and a molecular weight of 336.84 g/mol. Its IUPAC name is octan-2-yl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate.
| Compound Name | octan-2-yl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 65374892 |
| Molecular Formula | C13H21ClN2O4S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | octan-2-yl 4-chlorosulfonyl-5-methyl-1H-pyrazole-3-carboxylate |
| SMILES | CCCCCCC(C)OC(=O)c1n[nH]c(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H21ClN2O4S/c1-4-5-6-7-8-9(2)20-13(17)11-12(21(14,18)19)10(3)15-16-11/h9H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | VYCAZCZKHGQZJB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|