C11H18ClN3O3S — CID 65368456
3-(diethylcarbamoyl)-5-propan-2-yl-1H-pyrazole-4-sulfonyl chloride (PubChem CID 65368456) has the molecular formula C11H18ClN3O3S and a molecular weight of 307.80 g/mol. Its IUPAC name is 3-(diethylcarbamoyl)-5-propan-2-yl-1H-pyrazole-4-sulfonyl chloride.
| Compound Name | 3-(diethylcarbamoyl)-5-propan-2-yl-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 65368456 |
| Molecular Formula | C11H18ClN3O3S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-(diethylcarbamoyl)-5-propan-2-yl-1H-pyrazole-4-sulfonyl chloride |
| SMILES | CCN(CC)C(=O)c1n[nH]c(C(C)C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H18ClN3O3S/c1-5-15(6-2)11(16)9-10(19(12,17)18)8(7(3)4)13-14-9/h7H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | NMWKLHDIKDKQSX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |