C13H20ClN3O3S — CID 107402583
3-[cyclobutylmethyl(ethyl)carbamoyl]-5-ethyl-1H-pyrazole-4-sulfonyl chloride (PubChem CID 107402583) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is 3-[cyclobutylmethyl(ethyl)carbamoyl]-5-ethyl-1H-pyrazole-4-sulfonyl chloride.
| Compound Name | 3-[cyclobutylmethyl(ethyl)carbamoyl]-5-ethyl-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 107402583 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-[cyclobutylmethyl(ethyl)carbamoyl]-5-ethyl-1H-pyrazole-4-sulfonyl chloride |
| SMILES | CCc1[nH]nc(C(=O)N(CC)CC2CCC2)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H20ClN3O3S/c1-3-10-12(21(14,19)20)11(16-15-10)13(18)17(4-2)8-9-6-5-7-9/h9H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | GTPVENNZPHMAFA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |