C8H10F3N3O — CID 63228691
4-amino-N-(3,3,3-trifluoropropyl)-1H-pyrrole-2-carboxamide (PubChem CID 63228691) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is 4-amino-N-(3,3,3-trifluoropropyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(3,3,3-trifluoropropyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63228691 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 4-amino-N-(3,3,3-trifluoropropyl)-1H-pyrrole-2-carboxamide |
| SMILES | Nc1c[nH]c(C(=O)NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C8H10F3N3O/c9-8(10,11)1-2-13-7(15)6-3-5(12)4-14-6/h3-4,14H,1-2,12H2,(H,13,15) |
| InChIKey | MTXXEEAHKXBPEO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |