C11H15N5O — CID 61213141
4-amino-N-[2-(1-methylimidazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 61213141) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 4-amino-N-[2-(1-methylimidazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[2-(1-methylimidazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61213141 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 4-amino-N-[2-(1-methylimidazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cn1ccnc1CCNC(=O)c1cc(N)c[nH]1 |
| InChI | InChI=1S/C11H15N5O/c1-16-5-4-13-10(16)2-3-14-11(17)9-6-8(12)7-15-9/h4-7,15H,2-3,12H2,1H3,(H,14,17) |
| InChIKey | OHNFPLONVLLRML-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |