C10H14F3N3O3S — CID 63827628
3-amino-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenesulfonamide (PubChem CID 63827628) has the molecular formula C10H14F3N3O3S and a molecular weight of 313.30 g/mol. Its IUPAC name is 3-amino-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenesulfonamide.
| Compound Name | 3-amino-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 63827628 |
| Molecular Formula | C10H14F3N3O3S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-amino-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenesulfonamide |
| SMILES | Nc1cc(S(N)(=O)=O)ccc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O3S/c11-10(12,13)6-19-4-3-16-9-2-1-7(5-8(9)14)20(15,17)18/h1-2,5,16H,3-4,6,14H2,(H2,15,17,18) |
| InChIKey | LLVJMKQCLWCIIF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|