C14H26ClN3O2S — CID 102998558
5-(chloromethyl)-N-[3-(dimethylamino)propyl]-N,1-diethylpyrrole-3-sulfonamide (PubChem CID 102998558) has the molecular formula C14H26ClN3O2S and a molecular weight of 335.90 g/mol. Its IUPAC name is 5-(chloromethyl)-N-[3-(dimethylamino)propyl]-N,1-diethylpyrrole-3-sulfonamide.
| Compound Name | 5-(chloromethyl)-N-[3-(dimethylamino)propyl]-N,1-diethylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 102998558 |
| Molecular Formula | C14H26ClN3O2S |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-(chloromethyl)-N-[3-(dimethylamino)propyl]-N,1-diethylpyrrole-3-sulfonamide |
| SMILES | CCN(CCCN(C)C)S(=O)(=O)c1cc(CCl)n(CC)c1 |
| InChI | InChI=1S/C14H26ClN3O2S/c1-5-17-12-14(10-13(17)11-15)21(19,20)18(6-2)9-7-8-16(3)4/h10,12H,5-9,11H2,1-4H3 |
| InChIKey | QPDQOYLFYLHIRN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|