C10H15NO4S3 — CID 112657989
5-methyl-4-[methyl(2-methylsulfanylethyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 112657989) has the molecular formula C10H15NO4S3 and a molecular weight of 309.43 g/mol. Its IUPAC name is 5-methyl-4-[methyl(2-methylsulfanylethyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-methyl-4-[methyl(2-methylsulfanylethyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 112657989 |
| Molecular Formula | C10H15NO4S3 |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 5-methyl-4-[methyl(2-methylsulfanylethyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CSCCN(C)S(=O)(=O)c1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C10H15NO4S3/c1-7-9(6-8(17-7)10(12)13)18(14,15)11(2)4-5-16-3/h6H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | GLUAALDMQIAORW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |